C13H16INO5S — CID 103962419
2-iodo-5-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoic acid (PubChem CID 103962419) has the molecular formula C13H16INO5S and a molecular weight of 425.24 g/mol. Its IUPAC name is 2-iodo-5-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoic acid.
| Compound Name | 2-iodo-5-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 103962419 |
| Molecular Formula | C13H16INO5S |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 424.98 |
| IUPAC Name | 2-iodo-5-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoic acid |
| SMILES | CN(CC1CCCO1)S(=O)(=O)c1ccc(I)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H16INO5S/c1-15(8-9-3-2-6-20-9)21(18,19)10-4-5-12(14)11(7-10)13(16)17/h4-5,7,9H,2-3,6,8H2,1H3,(H,16,17) |
| InChIKey | OXPXINPAOSUHLZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|