C18H21N3O4S2 — CID 4835973
3-[(3-cyanophenyl)sulfonylamino]-N,N-diethyl-4-methylbenzenesulfonamide (PubChem CID 4835973) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 3-[(3-cyanophenyl)sulfonylamino]-N,N-diethyl-4-methylbenzenesulfonamide.
| Compound Name | 3-[(3-cyanophenyl)sulfonylamino]-N,N-diethyl-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 4835973 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 3-[(3-cyanophenyl)sulfonylamino]-N,N-diethyl-4-methylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(NS(=O)(=O)c2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C18H21N3O4S2/c1-4-21(5-2)27(24,25)17-10-9-14(3)18(12-17)20-26(22,23)16-8-6-7-15(11-16)13-19/h6-12,20H,4-5H2,1-3H3 |
| InChIKey | PVBOIQZGMFELIS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |