C16H18N4O4S2 — CID 30766179
3-[(3-cyanophenyl)sulfonylamino]-4-(propylamino)benzenesulfonamide (PubChem CID 30766179) has the molecular formula C16H18N4O4S2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 3-[(3-cyanophenyl)sulfonylamino]-4-(propylamino)benzenesulfonamide.
| Compound Name | 3-[(3-cyanophenyl)sulfonylamino]-4-(propylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 30766179 |
| Molecular Formula | C16H18N4O4S2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 3-[(3-cyanophenyl)sulfonylamino]-4-(propylamino)benzenesulfonamide |
| SMILES | CCCNc1ccc(S(N)(=O)=O)cc1NS(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C16H18N4O4S2/c1-2-8-19-15-7-6-13(25(18,21)22)10-16(15)20-26(23,24)14-5-3-4-12(9-14)11-17/h3-7,9-10,19-20H,2,8H2,1H3,(H2,18,21,22) |
| InChIKey | QNTVGKIMMGAWQD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 142.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |