C15H11Cl2N3O3S — CID 45273664
2-chloro-N-[4-chloro-2-[(3-cyanophenyl)sulfonylamino]phenyl]acetamide (PubChem CID 45273664) has the molecular formula C15H11Cl2N3O3S and a molecular weight of 384.24 g/mol. Its IUPAC name is 2-chloro-N-[4-chloro-2-[(3-cyanophenyl)sulfonylamino]phenyl]acetamide.
| Compound Name | 2-chloro-N-[4-chloro-2-[(3-cyanophenyl)sulfonylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 45273664 |
| Molecular Formula | C15H11Cl2N3O3S |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | 2-chloro-N-[4-chloro-2-[(3-cyanophenyl)sulfonylamino]phenyl]acetamide |
| SMILES | N#Cc1cccc(S(=O)(=O)Nc2cc(Cl)ccc2NC(=O)CCl)c1 |
| InChI | InChI=1S/C15H11Cl2N3O3S/c16-8-15(21)19-13-5-4-11(17)7-14(13)20-24(22,23)12-3-1-2-10(6-12)9-18/h1-7,20H,8H2,(H,19,21) |
| InChIKey | SIEFOSZMXTXHGC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|