C13H8F2N2O2S — CID 47336983
3-cyano-N-(2,3-difluorophenyl)benzenesulfonamide (PubChem CID 47336983) has the molecular formula C13H8F2N2O2S and a molecular weight of 294.28 g/mol. Its IUPAC name is 3-cyano-N-(2,3-difluorophenyl)benzenesulfonamide.
| Compound Name | 3-cyano-N-(2,3-difluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 47336983 |
| Molecular Formula | C13H8F2N2O2S |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 3-cyano-N-(2,3-difluorophenyl)benzenesulfonamide |
| SMILES | N#Cc1cccc(S(=O)(=O)Nc2cccc(F)c2F)c1 |
| InChI | InChI=1S/C13H8F2N2O2S/c14-11-5-2-6-12(13(11)15)17-20(18,19)10-4-1-3-9(7-10)8-16/h1-7,17H |
| InChIKey | ZNHWAJUFEFLZCQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |