C17H16N2O2S — CID 26970591
3-cyano-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzenesulfonamide (PubChem CID 26970591) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-cyano-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzenesulfonamide.
| Compound Name | 3-cyano-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 26970591 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 3-cyano-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzenesulfonamide |
| SMILES | N#Cc1cccc(S(=O)(=O)Nc2cccc3c2CCCC3)c1 |
| InChI | InChI=1S/C17H16N2O2S/c18-12-13-5-3-8-15(11-13)22(20,21)19-17-10-4-7-14-6-1-2-9-16(14)17/h3-5,7-8,10-11,19H,1-2,6,9H2 |
| InChIKey | XJCWZINKVVLIQI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |