C20H14Cl2N4O3S — CID 10367029
1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(2,3-dichlorophenyl)urea (PubChem CID 10367029) has the molecular formula C20H14Cl2N4O3S and a molecular weight of 461.33 g/mol. Its IUPAC name is 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 10367029 |
| Molecular Formula | C20H14Cl2N4O3S |
| Molecular Weight | 461.33 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(2,3-dichlorophenyl)urea |
| SMILES | N#Cc1ccc(NC(=O)Nc2cccc(Cl)c2Cl)c(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H14Cl2N4O3S/c21-15-7-4-8-17(19(15)22)25-20(27)24-16-10-9-13(12-23)11-18(16)26-30(28,29)14-5-2-1-3-6-14/h1-11,26H,(H2,24,25,27) |
| InChIKey | XMMCBSCKXNWDDS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.33 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |