C21H18N4O3S — CID 22011348
1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(2-methylphenyl)urea (PubChem CID 22011348) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(2-methylphenyl)urea.
| Compound Name | 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 22011348 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)Nc1ccc(C#N)cc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H18N4O3S/c1-15-7-5-6-10-18(15)23-21(26)24-19-12-11-16(14-22)13-20(19)25-29(27,28)17-8-3-2-4-9-17/h2-13,25H,1H3,(H2,23,24,26) |
| InChIKey | GLRSOWUQGPAHGM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |