C21H16Cl2N4O3S — CID 57266988
1-[4-(benzylsulfonylamino)-3-cyanophenyl]-3-(2,3-dichlorophenyl)urea (PubChem CID 57266988) has the molecular formula C21H16Cl2N4O3S and a molecular weight of 475.36 g/mol. Its IUPAC name is 1-[4-(benzylsulfonylamino)-3-cyanophenyl]-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-[4-(benzylsulfonylamino)-3-cyanophenyl]-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 57266988 |
| Molecular Formula | C21H16Cl2N4O3S |
| Molecular Weight | 475.36 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | 1-[4-(benzylsulfonylamino)-3-cyanophenyl]-3-(2,3-dichlorophenyl)urea |
| SMILES | N#Cc1cc(NC(=O)Nc2cccc(Cl)c2Cl)ccc1NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H16Cl2N4O3S/c22-17-7-4-8-19(20(17)23)26-21(28)25-16-9-10-18(15(11-16)12-24)27-31(29,30)13-14-5-2-1-3-6-14/h1-11,27H,13H2,(H2,25,26,28) |
| InChIKey | NJFHMJBLYSHSDK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.36 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |