C14H14ClN3O — CID 63254522
1-[3-(aminomethyl)phenyl]-3-(2-chlorophenyl)urea (PubChem CID 63254522) has the molecular formula C14H14ClN3O and a molecular weight of 275.74 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]-3-(2-chlorophenyl)urea.
| Compound Name | 1-[3-(aminomethyl)phenyl]-3-(2-chlorophenyl)urea |
|---|---|
| PubChem CID | 63254522 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]-3-(2-chlorophenyl)urea |
| SMILES | NCc1cccc(NC(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C14H14ClN3O/c15-12-6-1-2-7-13(12)18-14(19)17-11-5-3-4-10(8-11)9-16/h1-8H,9,16H2,(H2,17,18,19) |
| InChIKey | LCZFNOHRZALVOM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |