C20H25ClN4O2 — CID 119805291
(2S)-2-amino-N-[3-[[(2-chlorophenyl)carbamoylamino]methyl]phenyl]-4-methylpentanamide (PubChem CID 119805291) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-[[(2-chlorophenyl)carbamoylamino]methyl]phenyl]-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[3-[[(2-chlorophenyl)carbamoylamino]methyl]phenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 119805291 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (2S)-2-amino-N-[3-[[(2-chlorophenyl)carbamoylamino]methyl]phenyl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)Nc1cccc(CNC(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C20H25ClN4O2/c1-13(2)10-17(22)19(26)24-15-7-5-6-14(11-15)12-23-20(27)25-18-9-4-3-8-16(18)21/h3-9,11,13,17H,10,12,22H2,1-2H3,(H,24,26)(H2,23,25,27)/t17-/m0/s1 |
| InChIKey | ZFKVWUPYAPJJFD-KRWDZBQOSA-N |
| XLogP | 3.97 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |