C20H29N3O4S2 — CID 55487998
4-(butylamino)-3-[(4-tert-butylphenyl)sulfonylamino]benzenesulfonamide (PubChem CID 55487998) has the molecular formula C20H29N3O4S2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 4-(butylamino)-3-[(4-tert-butylphenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | 4-(butylamino)-3-[(4-tert-butylphenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 55487998 |
| Molecular Formula | C20H29N3O4S2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 4-(butylamino)-3-[(4-tert-butylphenyl)sulfonylamino]benzenesulfonamide |
| SMILES | CCCCNc1ccc(S(N)(=O)=O)cc1NS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H29N3O4S2/c1-5-6-13-22-18-12-11-17(28(21,24)25)14-19(18)23-29(26,27)16-9-7-15(8-10-16)20(2,3)4/h7-12,14,22-23H,5-6,13H2,1-4H3,(H2,21,24,25) |
| InChIKey | WRRZGLQQBOPZTG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|