C20H25N3O8S2 — CID 55488153
dimethyl 2-[[2-(butylamino)-5-sulfamoylphenyl]sulfamoyl]benzene-1,4-dicarboxylate (PubChem CID 55488153) has the molecular formula C20H25N3O8S2 and a molecular weight of 499.57 g/mol. Its IUPAC name is dimethyl 2-[[2-(butylamino)-5-sulfamoylphenyl]sulfamoyl]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(butylamino)-5-sulfamoylphenyl]sulfamoyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 55488153 |
| Molecular Formula | C20H25N3O8S2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | dimethyl 2-[[2-(butylamino)-5-sulfamoylphenyl]sulfamoyl]benzene-1,4-dicarboxylate |
| SMILES | CCCCNc1ccc(S(N)(=O)=O)cc1NS(=O)(=O)c1cc(C(=O)OC)ccc1C(=O)OC |
| InChI | InChI=1S/C20H25N3O8S2/c1-4-5-10-22-16-9-7-14(32(21,26)27)12-17(16)23-33(28,29)18-11-13(19(24)30-2)6-8-15(18)20(25)31-3/h6-9,11-12,22-23H,4-5,10H2,1-3H3,(H2,21,26,27) |
| InChIKey | ZZPMWPWVJOMTTK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 170.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|