C17H18BrNO6S2 — CID 155271638
methyl 3-[(2-bromo-5-methylsulfonylphenyl)sulfamoyl]-4-ethylbenzoate (PubChem CID 155271638) has the molecular formula C17H18BrNO6S2 and a molecular weight of 476.37 g/mol. Its IUPAC name is methyl 3-[(2-bromo-5-methylsulfonylphenyl)sulfamoyl]-4-ethylbenzoate.
| Compound Name | methyl 3-[(2-bromo-5-methylsulfonylphenyl)sulfamoyl]-4-ethylbenzoate |
|---|---|
| PubChem CID | 155271638 |
| Molecular Formula | C17H18BrNO6S2 |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 474.98 |
| IUPAC Name | methyl 3-[(2-bromo-5-methylsulfonylphenyl)sulfamoyl]-4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OC)cc1S(=O)(=O)Nc1cc(S(C)(=O)=O)ccc1Br |
| InChI | InChI=1S/C17H18BrNO6S2/c1-4-11-5-6-12(17(20)25-2)9-16(11)27(23,24)19-15-10-13(26(3,21)22)7-8-14(15)18/h5-10,19H,4H2,1-3H3 |
| InChIKey | GROOOBBLJMKCMH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |