C15H12Br3NO2 — CID 102766576
methyl 3-bromo-4-[(2,5-dibromoanilino)methyl]benzoate (PubChem CID 102766576) has the molecular formula C15H12Br3NO2 and a molecular weight of 477.98 g/mol. Its IUPAC name is methyl 3-bromo-4-[(2,5-dibromoanilino)methyl]benzoate.
| Compound Name | methyl 3-bromo-4-[(2,5-dibromoanilino)methyl]benzoate |
|---|---|
| PubChem CID | 102766576 |
| Molecular Formula | C15H12Br3NO2 |
| Molecular Weight | 477.98 g/mol |
| Exact Mass | 474.84 |
| IUPAC Name | methyl 3-bromo-4-[(2,5-dibromoanilino)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNc2cc(Br)ccc2Br)c(Br)c1 |
| InChI | InChI=1S/C15H12Br3NO2/c1-21-15(20)9-2-3-10(13(18)6-9)8-19-14-7-11(16)4-5-12(14)17/h2-7,19H,8H2,1H3 |
| InChIKey | RSURTLRRCWYENT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.98 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |