methyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate

C17H18BrNO2 — CID 102766636

IUPACmethyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate
SMILESCOC(=O)c1ccc(CNc2c(C)cccc2C)c(Br)c1
InChIInChI=1S/C17H18BrNO2/c1-11-5-4-6-12(2)16(11)19-10-14-8-7-13(9-15(14)18)17(20)21-3/h4-9,19H,10H2,1-3H3
InChIKeyKDQOHLQRHJPGAC-UHFFFAOYSA-N
MW348.24 g/mol
LogP4.46
Rot. Bonds4

About methyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate

methyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate (PubChem CID 102766636) has the molecular formula C17H18BrNO2 and a molecular weight of 348.24 g/mol. Its IUPAC name is methyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate.

Molecular Properties

Compound Namemethyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate
PubChem CID102766636
Molecular FormulaC17H18BrNO2
Molecular Weight348.24 g/mol
Exact Mass347.05
IUPAC Namemethyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate
SMILESCOC(=O)c1ccc(CNc2c(C)cccc2C)c(Br)c1
InChIInChI=1S/C17H18BrNO2/c1-11-5-4-6-12(2)16(11)19-10-14-8-7-13(9-15(14)18)17(20)21-3/h4-9,19H,10H2,1-3H3
InChIKeyKDQOHLQRHJPGAC-UHFFFAOYSA-N
XLogP4.46
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500348.24
LogP ≤ 54.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate?
The IUPAC name of methyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate (CID 102766636) is methyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate.
What is the SMILES notation for methyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate?
The canonical SMILES for methyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate is COC(=O)c1ccc(CNc2c(C)cccc2C)c(Br)c1.
What is the InChIKey of methyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate?
The InChIKey is KDQOHLQRHJPGAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18BrNO2/c1-11-5-4-6-12(2)16(11)19-10-14-8-7-13(9-15(14)18)17(20)21-3/h4-9,19H,10H2,1-3H3.
What are the key properties of methyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate?
methyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate has a molecular weight of 348.24 g/mol, XLogP of 4.46, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-4-[(2,6-dimethylanilino)methyl]benzoate is sourced from PubChem (CID 102766636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).