C22H19N3O4S — CID 155272018
methyl 3-[(5-cyano-2-pyridin-2-ylphenyl)sulfamoyl]-4-ethylbenzoate (PubChem CID 155272018) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is methyl 3-[(5-cyano-2-pyridin-2-ylphenyl)sulfamoyl]-4-ethylbenzoate.
| Compound Name | methyl 3-[(5-cyano-2-pyridin-2-ylphenyl)sulfamoyl]-4-ethylbenzoate |
|---|---|
| PubChem CID | 155272018 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | methyl 3-[(5-cyano-2-pyridin-2-ylphenyl)sulfamoyl]-4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OC)cc1S(=O)(=O)Nc1cc(C#N)ccc1-c1ccccn1 |
| InChI | InChI=1S/C22H19N3O4S/c1-3-16-8-9-17(22(26)29-2)13-21(16)30(27,28)25-20-12-15(14-23)7-10-18(20)19-6-4-5-11-24-19/h4-13,25H,3H2,1-2H3 |
| InChIKey | DUGQQZNSSBWGSX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |