C20H15FN2O5S2 — CID 155271954
methyl 3-[[5-cyano-2-(5-fluorothiophen-2-yl)phenyl]sulfamoyl]-4-methoxybenzoate (PubChem CID 155271954) has the molecular formula C20H15FN2O5S2 and a molecular weight of 446.48 g/mol. Its IUPAC name is methyl 3-[[5-cyano-2-(5-fluorothiophen-2-yl)phenyl]sulfamoyl]-4-methoxybenzoate.
| Compound Name | methyl 3-[[5-cyano-2-(5-fluorothiophen-2-yl)phenyl]sulfamoyl]-4-methoxybenzoate |
|---|---|
| PubChem CID | 155271954 |
| Molecular Formula | C20H15FN2O5S2 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | methyl 3-[[5-cyano-2-(5-fluorothiophen-2-yl)phenyl]sulfamoyl]-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(S(=O)(=O)Nc2cc(C#N)ccc2-c2ccc(F)s2)c1 |
| InChI | InChI=1S/C20H15FN2O5S2/c1-27-16-6-4-13(20(24)28-2)10-18(16)30(25,26)23-15-9-12(11-22)3-5-14(15)17-7-8-19(21)29-17/h3-10,23H,1-2H3 |
| InChIKey | VXRFUKPOLNGYIJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |