C20H17N5O5S2 — CID 155271665
methyl 4-methoxy-3-[[5-(2H-tetrazol-5-yl)-2-thiophen-2-ylphenyl]sulfamoyl]benzoate (PubChem CID 155271665) has the molecular formula C20H17N5O5S2 and a molecular weight of 471.52 g/mol. Its IUPAC name is methyl 4-methoxy-3-[[5-(2H-tetrazol-5-yl)-2-thiophen-2-ylphenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-methoxy-3-[[5-(2H-tetrazol-5-yl)-2-thiophen-2-ylphenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 155271665 |
| Molecular Formula | C20H17N5O5S2 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | methyl 4-methoxy-3-[[5-(2H-tetrazol-5-yl)-2-thiophen-2-ylphenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(OC)c(S(=O)(=O)Nc2cc(-c3nn[nH]n3)ccc2-c2cccs2)c1 |
| InChI | InChI=1S/C20H17N5O5S2/c1-29-16-8-6-13(20(26)30-2)11-18(16)32(27,28)23-15-10-12(19-21-24-25-22-19)5-7-14(15)17-4-3-9-31-17/h3-11,23H,1-2H3,(H,21,22,24,25) |
| InChIKey | KIZHTRLPQGPREP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |