C22H18F3NO4S2 — CID 155718047
methyl 4-cyclopropyl-3-[[2-thiophen-2-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate (PubChem CID 155718047) has the molecular formula C22H18F3NO4S2 and a molecular weight of 481.52 g/mol. Its IUPAC name is methyl 4-cyclopropyl-3-[[2-thiophen-2-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-cyclopropyl-3-[[2-thiophen-2-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 155718047 |
| Molecular Formula | C22H18F3NO4S2 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | methyl 4-cyclopropyl-3-[[2-thiophen-2-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C2CC2)c(S(=O)(=O)Nc2cc(C(F)(F)F)ccc2-c2cccs2)c1 |
| InChI | InChI=1S/C22H18F3NO4S2/c1-30-21(27)14-6-8-16(13-4-5-13)20(11-14)32(28,29)26-18-12-15(22(23,24)25)7-9-17(18)19-3-2-10-31-19/h2-3,6-13,26H,4-5H2,1H3 |
| InChIKey | NUBCMJRJHCDIDO-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |