C21H14BrF4NO4S — CID 155271636
methyl 4-bromo-3-[[2-(3-fluorophenyl)-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate (PubChem CID 155271636) has the molecular formula C21H14BrF4NO4S and a molecular weight of 532.31 g/mol. Its IUPAC name is methyl 4-bromo-3-[[2-(3-fluorophenyl)-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-bromo-3-[[2-(3-fluorophenyl)-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 155271636 |
| Molecular Formula | C21H14BrF4NO4S |
| Molecular Weight | 532.31 g/mol |
| Exact Mass | 530.98 |
| IUPAC Name | methyl 4-bromo-3-[[2-(3-fluorophenyl)-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(Br)c(S(=O)(=O)Nc2cc(C(F)(F)F)ccc2-c2cccc(F)c2)c1 |
| InChI | InChI=1S/C21H14BrF4NO4S/c1-31-20(28)13-5-8-17(22)19(10-13)32(29,30)27-18-11-14(21(24,25)26)6-7-16(18)12-3-2-4-15(23)9-12/h2-11,27H,1H3 |
| InChIKey | BSBUKVLBMOHHIB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.31 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |