C16H14F3NO4S — CID 99600303
methyl 4-methyl-3-[[2-(trifluoromethyl)phenyl]sulfamoyl]benzoate (PubChem CID 99600303) has the molecular formula C16H14F3NO4S and a molecular weight of 373.35 g/mol. Its IUPAC name is methyl 4-methyl-3-[[2-(trifluoromethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-methyl-3-[[2-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 99600303 |
| Molecular Formula | C16H14F3NO4S |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | methyl 4-methyl-3-[[2-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C)c(S(=O)(=O)Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F3NO4S/c1-10-7-8-11(15(21)24-2)9-14(10)25(22,23)20-13-6-4-3-5-12(13)16(17,18)19/h3-9,20H,1-2H3 |
| InChIKey | NHEYOTBDDLCIND-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |