C20H25NO4S — CID 7938266
methyl 3-[(5-tert-butyl-2-methylphenyl)sulfonylamino]-4-methylbenzoate (PubChem CID 7938266) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is methyl 3-[(5-tert-butyl-2-methylphenyl)sulfonylamino]-4-methylbenzoate.
| Compound Name | methyl 3-[(5-tert-butyl-2-methylphenyl)sulfonylamino]-4-methylbenzoate |
|---|---|
| PubChem CID | 7938266 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | methyl 3-[(5-tert-butyl-2-methylphenyl)sulfonylamino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NS(=O)(=O)c2cc(C(C)(C)C)ccc2C)c1 |
| InChI | InChI=1S/C20H25NO4S/c1-13-7-9-15(19(22)25-6)11-17(13)21-26(23,24)18-12-16(20(3,4)5)10-8-14(18)2/h7-12,21H,1-6H3 |
| InChIKey | WKYFEIGNXQIWBF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |