C19H22ClNO4S — CID 2493561
methyl 2-[(5-tert-butyl-2-methylphenyl)sulfonylamino]-4-chlorobenzoate (PubChem CID 2493561) has the molecular formula C19H22ClNO4S and a molecular weight of 395.91 g/mol. Its IUPAC name is methyl 2-[(5-tert-butyl-2-methylphenyl)sulfonylamino]-4-chlorobenzoate.
| Compound Name | methyl 2-[(5-tert-butyl-2-methylphenyl)sulfonylamino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 2493561 |
| Molecular Formula | C19H22ClNO4S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | methyl 2-[(5-tert-butyl-2-methylphenyl)sulfonylamino]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1NS(=O)(=O)c1cc(C(C)(C)C)ccc1C |
| InChI | InChI=1S/C19H22ClNO4S/c1-12-6-7-13(19(2,3)4)10-17(12)26(23,24)21-16-11-14(20)8-9-15(16)18(22)25-5/h6-11,21H,1-5H3 |
| InChIKey | ILGSZXGYHWQRPZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |