C16H15NO6S — CID 24502065
3-[(2-methoxycarbonylphenyl)sulfamoyl]-4-methylbenzoic acid (PubChem CID 24502065) has the molecular formula C16H15NO6S and a molecular weight of 349.36 g/mol. Its IUPAC name is 3-[(2-methoxycarbonylphenyl)sulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-[(2-methoxycarbonylphenyl)sulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 24502065 |
| Molecular Formula | C16H15NO6S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 3-[(2-methoxycarbonylphenyl)sulfamoyl]-4-methylbenzoic acid |
| SMILES | COC(=O)c1ccccc1NS(=O)(=O)c1cc(C(=O)O)ccc1C |
| InChI | InChI=1S/C16H15NO6S/c1-10-7-8-11(15(18)19)9-14(10)24(21,22)17-13-6-4-3-5-12(13)16(20)23-2/h3-9,17H,1-2H3,(H,18,19) |
| InChIKey | UTUIHWMKZTTWDH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |