C19H24ClNO3S — CID 7940782
5-tert-butyl-N-(4-chloro-2-methoxy-5-methylphenyl)-2-methylbenzenesulfonamide (PubChem CID 7940782) has the molecular formula C19H24ClNO3S and a molecular weight of 381.93 g/mol. Its IUPAC name is 5-tert-butyl-N-(4-chloro-2-methoxy-5-methylphenyl)-2-methylbenzenesulfonamide.
| Compound Name | 5-tert-butyl-N-(4-chloro-2-methoxy-5-methylphenyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 7940782 |
| Molecular Formula | C19H24ClNO3S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 5-tert-butyl-N-(4-chloro-2-methoxy-5-methylphenyl)-2-methylbenzenesulfonamide |
| SMILES | COc1cc(Cl)c(C)cc1NS(=O)(=O)c1cc(C(C)(C)C)ccc1C |
| InChI | InChI=1S/C19H24ClNO3S/c1-12-7-8-14(19(3,4)5)10-18(12)25(22,23)21-16-9-13(2)15(20)11-17(16)24-6/h7-11,21H,1-6H3 |
| InChIKey | PNFWNDGAMCEHFT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |