C14H11ClF3NO3S — CID 8523518
N-(4-chloro-2-methoxy-5-methylphenyl)-2,3,4-trifluorobenzenesulfonamide (PubChem CID 8523518) has the molecular formula C14H11ClF3NO3S and a molecular weight of 365.76 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-2,3,4-trifluorobenzenesulfonamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2,3,4-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 8523518 |
| Molecular Formula | C14H11ClF3NO3S |
| Molecular Weight | 365.76 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2,3,4-trifluorobenzenesulfonamide |
| SMILES | COc1cc(Cl)c(C)cc1NS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H11ClF3NO3S/c1-7-5-10(11(22-2)6-8(7)15)19-23(20,21)12-4-3-9(16)13(17)14(12)18/h3-6,19H,1-2H3 |
| InChIKey | HQDVXSLGXDCGSX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.76 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|