C12H12ClNO3S2 — CID 8523500
N-(4-chloro-2-methoxy-5-methylphenyl)thiophene-2-sulfonamide (PubChem CID 8523500) has the molecular formula C12H12ClNO3S2 and a molecular weight of 317.82 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)thiophene-2-sulfonamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 8523500 |
| Molecular Formula | C12H12ClNO3S2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)thiophene-2-sulfonamide |
| SMILES | COc1cc(Cl)c(C)cc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H12ClNO3S2/c1-8-6-10(11(17-2)7-9(8)13)14-19(15,16)12-4-3-5-18-12/h3-7,14H,1-2H3 |
| InChIKey | ZIZDDZKMZPZTJM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |