C15H17ClN2O4S2 — CID 36749120
N-(4-chloro-2-methoxy-5-methylphenyl)-3-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 36749120) has the molecular formula C15H17ClN2O4S2 and a molecular weight of 388.90 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-3-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-3-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 36749120 |
| Molecular Formula | C15H17ClN2O4S2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-3-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)CCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H17ClN2O4S2/c1-10-8-12(13(22-2)9-11(10)16)18-14(19)5-6-17-24(20,21)15-4-3-7-23-15/h3-4,7-9,17H,5-6H2,1-2H3,(H,18,19) |
| InChIKey | JEVPWGIOKPUHHN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |