C23H20F3NO5S — CID 155271434
methyl 4-methoxy-3-[[2-(3-methylphenyl)-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate (PubChem CID 155271434) has the molecular formula C23H20F3NO5S and a molecular weight of 479.48 g/mol. Its IUPAC name is methyl 4-methoxy-3-[[2-(3-methylphenyl)-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-methoxy-3-[[2-(3-methylphenyl)-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 155271434 |
| Molecular Formula | C23H20F3NO5S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | methyl 4-methoxy-3-[[2-(3-methylphenyl)-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(OC)c(S(=O)(=O)Nc2cc(C(F)(F)F)ccc2-c2cccc(C)c2)c1 |
| InChI | InChI=1S/C23H20F3NO5S/c1-14-5-4-6-15(11-14)18-9-8-17(23(24,25)26)13-19(18)27-33(29,30)21-12-16(22(28)32-3)7-10-20(21)31-2/h4-13,27H,1-3H3 |
| InChIKey | QAYIIGWXTYVYBH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |