C21H15F4NO5S — CID 166018852
3-[[2-(2-fluorophenyl)-5-(trifluoromethyl)phenyl]sulfamoyl]-4-methoxybenzoic acid (PubChem CID 166018852) has the molecular formula C21H15F4NO5S and a molecular weight of 469.41 g/mol. Its IUPAC name is 3-[[2-(2-fluorophenyl)-5-(trifluoromethyl)phenyl]sulfamoyl]-4-methoxybenzoic acid.
| Compound Name | 3-[[2-(2-fluorophenyl)-5-(trifluoromethyl)phenyl]sulfamoyl]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 166018852 |
| Molecular Formula | C21H15F4NO5S |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 3-[[2-(2-fluorophenyl)-5-(trifluoromethyl)phenyl]sulfamoyl]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1S(=O)(=O)Nc1cc(C(F)(F)F)ccc1-c1ccccc1F |
| InChI | InChI=1S/C21H15F4NO5S/c1-31-18-9-6-12(20(27)28)10-19(18)32(29,30)26-17-11-13(21(23,24)25)7-8-15(17)14-4-2-3-5-16(14)22/h2-11,26H,1H3,(H,27,28) |
| InChIKey | SRVAOWWUTAXJML-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |