C21H15BrF3NO4S — CID 166018828
methyl 4-bromo-3-[[2-phenyl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate (PubChem CID 166018828) has the molecular formula C21H15BrF3NO4S and a molecular weight of 514.32 g/mol. Its IUPAC name is methyl 4-bromo-3-[[2-phenyl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-bromo-3-[[2-phenyl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 166018828 |
| Molecular Formula | C21H15BrF3NO4S |
| Molecular Weight | 514.32 g/mol |
| Exact Mass | 512.99 |
| IUPAC Name | methyl 4-bromo-3-[[2-phenyl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(Br)c(S(=O)(=O)Nc2cc(C(F)(F)F)ccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C21H15BrF3NO4S/c1-30-20(27)14-7-10-17(22)19(11-14)31(28,29)26-18-12-15(21(23,24)25)8-9-16(18)13-5-3-2-4-6-13/h2-12,26H,1H3 |
| InChIKey | VFEMZHKVRHAZMM-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.32 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |