C20H21F3N2O5S — CID 156773332
methyl 4-hydroxy-3-[[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate (PubChem CID 156773332) has the molecular formula C20H21F3N2O5S and a molecular weight of 458.46 g/mol. Its IUPAC name is methyl 4-hydroxy-3-[[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-hydroxy-3-[[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 156773332 |
| Molecular Formula | C20H21F3N2O5S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | methyl 4-hydroxy-3-[[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(O)c(S(=O)(=O)Nc2cc(C(F)(F)F)ccc2N2CCCCC2)c1 |
| InChI | InChI=1S/C20H21F3N2O5S/c1-30-19(27)13-5-8-17(26)18(11-13)31(28,29)24-15-12-14(20(21,22)23)6-7-16(15)25-9-3-2-4-10-25/h5-8,11-12,24,26H,2-4,9-10H2,1H3 |
| InChIKey | LGNRHWIRRMIDRD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |