C20H24F3N3O5S — CID 86765332
azanium 4-methoxy-3-[[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate (PubChem CID 86765332) has the molecular formula C20H24F3N3O5S and a molecular weight of 475.49 g/mol. Its IUPAC name is azanium 4-methoxy-3-[[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | azanium 4-methoxy-3-[[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 86765332 |
| Molecular Formula | C20H24F3N3O5S |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | azanium 4-methoxy-3-[[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
| SMILES | COc1ccc(C(=O)[O-])cc1S(=O)(=O)Nc1cc(C(F)(F)F)ccc1N1CCCCC1.[NH4+] |
| InChI | InChI=1S/C20H21F3N2O5S.H3N/c1-30-17-8-5-13(19(26)27)11-18(17)31(28,29)24-15-12-14(20(21,22)23)6-7-16(15)25-9-3-2-4-10-25;/h5-8,11-12,24H,2-4,9-10H2,1H3,(H,26,27);1H3 |
| InChIKey | PVLSIVTWMZTSPN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |