C17H15BrF3NO4S — CID 155271841
methyl 3-[[2-bromo-5-(trifluoromethyl)phenyl]sulfamoyl]-4-ethylbenzoate (PubChem CID 155271841) has the molecular formula C17H15BrF3NO4S and a molecular weight of 466.28 g/mol. Its IUPAC name is methyl 3-[[2-bromo-5-(trifluoromethyl)phenyl]sulfamoyl]-4-ethylbenzoate.
| Compound Name | methyl 3-[[2-bromo-5-(trifluoromethyl)phenyl]sulfamoyl]-4-ethylbenzoate |
|---|---|
| PubChem CID | 155271841 |
| Molecular Formula | C17H15BrF3NO4S |
| Molecular Weight | 466.28 g/mol |
| Exact Mass | 464.99 |
| IUPAC Name | methyl 3-[[2-bromo-5-(trifluoromethyl)phenyl]sulfamoyl]-4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OC)cc1S(=O)(=O)Nc1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C17H15BrF3NO4S/c1-3-10-4-5-11(16(23)26-2)8-15(10)27(24,25)22-14-9-12(17(19,20)21)6-7-13(14)18/h4-9,22H,3H2,1-2H3 |
| InChIKey | CBCOQKLNVDUFBR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.28 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |