C21H17ClF3NO5S — CID 3670999
5-chloro-2-methoxy-N-[2-(2-methoxyphenoxy)-5-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 3670999) has the molecular formula C21H17ClF3NO5S and a molecular weight of 487.88 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[2-(2-methoxyphenoxy)-5-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 5-chloro-2-methoxy-N-[2-(2-methoxyphenoxy)-5-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3670999 |
| Molecular Formula | C21H17ClF3NO5S |
| Molecular Weight | 487.88 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | 5-chloro-2-methoxy-N-[2-(2-methoxyphenoxy)-5-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | COc1ccccc1Oc1ccc(C(F)(F)F)cc1NS(=O)(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C21H17ClF3NO5S/c1-29-17-5-3-4-6-18(17)31-16-9-7-13(21(23,24)25)11-15(16)26-32(27,28)20-12-14(22)8-10-19(20)30-2/h3-12,26H,1-2H3 |
| InChIKey | DORRGYXRXOWGKK-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.88 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |