C17H17BrF3NO5S — CID 26983087
5-bromo-2-methoxy-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 26983087) has the molecular formula C17H17BrF3NO5S and a molecular weight of 484.29 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 5-bromo-2-methoxy-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26983087 |
| Molecular Formula | C17H17BrF3NO5S |
| Molecular Weight | 484.29 g/mol |
| Exact Mass | 483.00 |
| IUPAC Name | 5-bromo-2-methoxy-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NS(=O)(=O)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C17H17BrF3NO5S/c1-25-7-8-27-14-5-3-11(17(19,20)21)9-13(14)22-28(23,24)16-10-12(18)4-6-15(16)26-2/h3-6,9-10,22H,7-8H2,1-2H3 |
| InChIKey | AMTBEPARZOBBPE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|