C15H17ClF3N3O4S — CID 55879939
5-chloro-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 55879939) has the molecular formula C15H17ClF3N3O4S and a molecular weight of 427.83 g/mol. Its IUPAC name is 5-chloro-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | 5-chloro-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 55879939 |
| Molecular Formula | C15H17ClF3N3O4S |
| Molecular Weight | 427.83 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 5-chloro-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NS(=O)(=O)c1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C15H17ClF3N3O4S/c1-9-13(14(16)22(2)20-9)27(23,24)21-11-8-10(15(17,18)19)4-5-12(11)26-7-6-25-3/h4-5,8,21H,6-7H2,1-3H3 |
| InChIKey | XTNHMZLPDQDRLB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.83 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|