C17H24ClN3O3S — CID 55873493
N-[2-(4-tert-butylphenoxy)ethyl]-5-chloro-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 55873493) has the molecular formula C17H24ClN3O3S and a molecular weight of 385.92 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-5-chloro-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-5-chloro-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 55873493 |
| Molecular Formula | C17H24ClN3O3S |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-5-chloro-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)c(Cl)c1S(=O)(=O)NCCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H24ClN3O3S/c1-12-15(16(18)21(5)20-12)25(22,23)19-10-11-24-14-8-6-13(7-9-14)17(2,3)4/h6-9,19H,10-11H2,1-5H3 |
| InChIKey | RODSTDCOBUDQEO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|