C9H16ClN3O2S — CID 3765982
N-butyl-5-chloro-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 3765982) has the molecular formula C9H16ClN3O2S and a molecular weight of 265.77 g/mol. Its IUPAC name is N-butyl-5-chloro-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-butyl-5-chloro-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 3765982 |
| Molecular Formula | C9H16ClN3O2S |
| Molecular Weight | 265.77 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-butyl-5-chloro-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C9H16ClN3O2S/c1-4-5-6-11-16(14,15)8-7(2)12-13(3)9(8)10/h11H,4-6H2,1-3H3 |
| InChIKey | GMTUHDYYYQWZEA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.77 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|