C23H33NO4S — CID 100561505
N-[2-(4-tert-butylphenoxy)ethyl]-4-methoxy-2-methyl-5-propan-2-ylbenzenesulfonamide (PubChem CID 100561505) has the molecular formula C23H33NO4S and a molecular weight of 419.59 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-4-methoxy-2-methyl-5-propan-2-ylbenzenesulfonamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-4-methoxy-2-methyl-5-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 100561505 |
| Molecular Formula | C23H33NO4S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-4-methoxy-2-methyl-5-propan-2-ylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)NCCOc2ccc(C(C)(C)C)cc2)cc1C(C)C |
| InChI | InChI=1S/C23H33NO4S/c1-16(2)20-15-22(17(3)14-21(20)27-7)29(25,26)24-12-13-28-19-10-8-18(9-11-19)23(4,5)6/h8-11,14-16,24H,12-13H2,1-7H3 |
| InChIKey | DAZBGMBSFYKTAK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|