About (4-tert-butylphenyl) 2-methoxy-4-methyl-5-propan-2-ylbenzenesulfonate
(4-tert-butylphenyl) 2-methoxy-4-methyl-5-propan-2-ylbenzenesulfonate (PubChem CID 146147452) has the molecular formula C21H28O4S
and a molecular weight of 376.52 g/mol. Its IUPAC name is (4-tert-butylphenyl) 2-methoxy-4-methyl-5-propan-2-ylbenzenesulfonate.
Molecular Properties
| Compound Name | (4-tert-butylphenyl) 2-methoxy-4-methyl-5-propan-2-ylbenzenesulfonate |
| PubChem CID | 146147452 |
| Molecular Formula | C21H28O4S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (4-tert-butylphenyl) 2-methoxy-4-methyl-5-propan-2-ylbenzenesulfonate |
| SMILES | COc1cc(C)c(C(C)C)cc1S(=O)(=O)Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H28O4S/c1-14(2)18-13-20(19(24-7)12-15(18)3)26(22,23)25-17-10-8-16(9-11-17)21(4,5)6/h8-14H,1-7H3 |
| InChIKey | BRICYRJRERBNIW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butylphenyl) 2-methoxy-4-methyl-5-propan-2-ylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylphenyl) 2-methoxy-4-methyl-5-propan-2-ylbenzenesulfonate?
The IUPAC name of (4-tert-butylphenyl) 2-methoxy-4-methyl-5-propan-2-ylbenzenesulfonate (CID 146147452) is (4-tert-butylphenyl) 2-methoxy-4-methyl-5-propan-2-ylbenzenesulfonate.
What is the SMILES notation for (4-tert-butylphenyl) 2-methoxy-4-methyl-5-propan-2-ylbenzenesulfonate?
The canonical SMILES for (4-tert-butylphenyl) 2-methoxy-4-methyl-5-propan-2-ylbenzenesulfonate is COc1cc(C)c(C(C)C)cc1S(=O)(=O)Oc1ccc(C(C)(C)C)cc1.
What is the InChIKey of (4-tert-butylphenyl) 2-methoxy-4-methyl-5-propan-2-ylbenzenesulfonate?
The InChIKey is BRICYRJRERBNIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O4S/c1-14(2)18-13-20(19(24-7)12-15(18)3)26(22,23)25-17-10-8-16(9-11-17)21(4,5)6/h8-14H,1-7H3.
What are the key properties of (4-tert-butylphenyl) 2-methoxy-4-methyl-5-propan-2-ylbenzenesulfonate?
(4-tert-butylphenyl) 2-methoxy-4-methyl-5-propan-2-ylbenzenesulfonate has a molecular weight of 376.52 g/mol, XLogP of 5.19, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylphenyl) 2-methoxy-4-methyl-5-propan-2-ylbenzenesulfonate is sourced from PubChem (CID 146147452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).