C17H20O5S — CID 39845718
(3,5-dimethylphenyl) 2,5-dimethoxy-4-methylbenzenesulfonate (PubChem CID 39845718) has the molecular formula C17H20O5S and a molecular weight of 336.41 g/mol. Its IUPAC name is (3,5-dimethylphenyl) 2,5-dimethoxy-4-methylbenzenesulfonate.
| Compound Name | (3,5-dimethylphenyl) 2,5-dimethoxy-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 39845718 |
| Molecular Formula | C17H20O5S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (3,5-dimethylphenyl) 2,5-dimethoxy-4-methylbenzenesulfonate |
| SMILES | COc1cc(S(=O)(=O)Oc2cc(C)cc(C)c2)c(OC)cc1C |
| InChI | InChI=1S/C17H20O5S/c1-11-6-12(2)8-14(7-11)22-23(18,19)17-10-15(20-4)13(3)9-16(17)21-5/h6-10H,1-5H3 |
| InChIKey | RPOUHLCLLZHOPB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|