C18H21BrO3S — CID 166332913
(3-methyl-4-propan-2-ylphenyl) 4-bromo-2,5-dimethylbenzenesulfonate (PubChem CID 166332913) has the molecular formula C18H21BrO3S and a molecular weight of 397.33 g/mol. Its IUPAC name is (3-methyl-4-propan-2-ylphenyl) 4-bromo-2,5-dimethylbenzenesulfonate.
| Compound Name | (3-methyl-4-propan-2-ylphenyl) 4-bromo-2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 166332913 |
| Molecular Formula | C18H21BrO3S |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | (3-methyl-4-propan-2-ylphenyl) 4-bromo-2,5-dimethylbenzenesulfonate |
| SMILES | Cc1cc(S(=O)(=O)Oc2ccc(C(C)C)c(C)c2)c(C)cc1Br |
| InChI | InChI=1S/C18H21BrO3S/c1-11(2)16-7-6-15(8-12(16)3)22-23(20,21)18-10-13(4)17(19)9-14(18)5/h6-11H,1-5H3 |
| InChIKey | RDAUPLLMWMKOIS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|