C15H15BrO4S — CID 146147483
(4-methoxyphenyl) 5-bromo-2,4-dimethylbenzenesulfonate (PubChem CID 146147483) has the molecular formula C15H15BrO4S and a molecular weight of 371.25 g/mol. Its IUPAC name is (4-methoxyphenyl) 5-bromo-2,4-dimethylbenzenesulfonate.
| Compound Name | (4-methoxyphenyl) 5-bromo-2,4-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 146147483 |
| Molecular Formula | C15H15BrO4S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | (4-methoxyphenyl) 5-bromo-2,4-dimethylbenzenesulfonate |
| SMILES | COc1ccc(OS(=O)(=O)c2cc(Br)c(C)cc2C)cc1 |
| InChI | InChI=1S/C15H15BrO4S/c1-10-8-11(2)15(9-14(10)16)21(17,18)20-13-6-4-12(19-3)5-7-13/h4-9H,1-3H3 |
| InChIKey | CMDJYLWFXXLWFV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|