C17H13BrClNO3S — CID 91669670
(5-chloroquinolin-8-yl) 5-bromo-2,4-dimethylbenzenesulfonate (PubChem CID 91669670) has the molecular formula C17H13BrClNO3S and a molecular weight of 426.72 g/mol. Its IUPAC name is (5-chloroquinolin-8-yl) 5-bromo-2,4-dimethylbenzenesulfonate.
| Compound Name | (5-chloroquinolin-8-yl) 5-bromo-2,4-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 91669670 |
| Molecular Formula | C17H13BrClNO3S |
| Molecular Weight | 426.72 g/mol |
| Exact Mass | 424.95 |
| IUPAC Name | (5-chloroquinolin-8-yl) 5-bromo-2,4-dimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)Oc2ccc(Cl)c3cccnc23)cc1Br |
| InChI | InChI=1S/C17H13BrClNO3S/c1-10-8-11(2)16(9-13(10)18)24(21,22)23-15-6-5-14(19)12-4-3-7-20-17(12)15/h3-9H,1-2H3 |
| InChIKey | LHSUWFIPOFODET-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.72 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|