C16H10Br2ClNO3S — CID 21240819
(5,7-dibromoquinolin-8-yl) 4-chloro-3-methylbenzenesulfonate (PubChem CID 21240819) has the molecular formula C16H10Br2ClNO3S and a molecular weight of 491.59 g/mol. Its IUPAC name is (5,7-dibromoquinolin-8-yl) 4-chloro-3-methylbenzenesulfonate.
| Compound Name | (5,7-dibromoquinolin-8-yl) 4-chloro-3-methylbenzenesulfonate |
|---|---|
| PubChem CID | 21240819 |
| Molecular Formula | C16H10Br2ClNO3S |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 488.84 |
| IUPAC Name | (5,7-dibromoquinolin-8-yl) 4-chloro-3-methylbenzenesulfonate |
| SMILES | Cc1cc(S(=O)(=O)Oc2c(Br)cc(Br)c3cccnc23)ccc1Cl |
| InChI | InChI=1S/C16H10Br2ClNO3S/c1-9-7-10(4-5-14(9)19)24(21,22)23-16-13(18)8-12(17)11-3-2-6-20-15(11)16/h2-8H,1H3 |
| InChIKey | HMVQAMXCOWACKC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|