C21H21Br2NO4S — CID 146095943
(5,7-dibromoquinolin-8-yl) 5-tert-butyl-2-ethoxybenzenesulfonate (PubChem CID 146095943) has the molecular formula C21H21Br2NO4S and a molecular weight of 543.28 g/mol. Its IUPAC name is (5,7-dibromoquinolin-8-yl) 5-tert-butyl-2-ethoxybenzenesulfonate.
| Compound Name | (5,7-dibromoquinolin-8-yl) 5-tert-butyl-2-ethoxybenzenesulfonate |
|---|---|
| PubChem CID | 146095943 |
| Molecular Formula | C21H21Br2NO4S |
| Molecular Weight | 543.28 g/mol |
| Exact Mass | 540.96 |
| IUPAC Name | (5,7-dibromoquinolin-8-yl) 5-tert-butyl-2-ethoxybenzenesulfonate |
| SMILES | CCOc1ccc(C(C)(C)C)cc1S(=O)(=O)Oc1c(Br)cc(Br)c2cccnc12 |
| InChI | InChI=1S/C21H21Br2NO4S/c1-5-27-17-9-8-13(21(2,3)4)11-18(17)29(25,26)28-20-16(23)12-15(22)14-7-6-10-24-19(14)20/h6-12H,5H2,1-4H3 |
| InChIKey | PAYCWNMBIYLWIJ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.28 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|