About 8-Ethoxy-5-quinolinesulfonic acid sodium salt monohydrate
8-Ethoxy-5-quinolinesulfonic acid sodium salt monohydrate (PubChem CID 45157436) has the molecular formula C11H13NNaO5S
and a molecular weight of 294.28 g/mol.
Molecular Properties
| Compound Name | 8-Ethoxy-5-quinolinesulfonic acid sodium salt monohydrate |
| PubChem CID | 45157436 |
| Molecular Formula | C11H13NNaO5S |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | — |
| SMILES | CCOc1ccc(S(=O)(=O)O)c2cccnc12.O.[Na] |
| InChI | InChI=1S/C11H11NO4S.Na.H2O/c1-2-16-9-5-6-10(17(13,14)15)8-4-3-7-12-11(8)9;;/h3-7H,2H2,1H3,(H,13,14,15);;1H2 |
| InChIKey | ZMAXNPJEBDHUPM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 8-Ethoxy-5-quinolinesulfonic acid sodium salt monohydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-Ethoxy-5-quinolinesulfonic acid sodium salt monohydrate?
The IUPAC name of 8-Ethoxy-5-quinolinesulfonic acid sodium salt monohydrate (CID 45157436) is not available.
What is the SMILES notation for 8-Ethoxy-5-quinolinesulfonic acid sodium salt monohydrate?
The canonical SMILES for 8-Ethoxy-5-quinolinesulfonic acid sodium salt monohydrate is CCOc1ccc(S(=O)(=O)O)c2cccnc12.O.[Na].
What is the InChIKey of 8-Ethoxy-5-quinolinesulfonic acid sodium salt monohydrate?
The InChIKey is ZMAXNPJEBDHUPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4S.Na.H2O/c1-2-16-9-5-6-10(17(13,14)15)8-4-3-7-12-11(8)9;;/h3-7H,2H2,1H3,(H,13,14,15);;1H2.
What are the key properties of 8-Ethoxy-5-quinolinesulfonic acid sodium salt monohydrate?
8-Ethoxy-5-quinolinesulfonic acid sodium salt monohydrate has a molecular weight of 294.28 g/mol, XLogP of 0.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-Ethoxy-5-quinolinesulfonic acid sodium salt monohydrate is sourced from PubChem (CID 45157436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).