C12H13NaO4S — CID 173109617
sodium;4-ethoxynaphthalene-1-sulfonic acid;hydride (PubChem CID 173109617) has the molecular formula C12H13NaO4S and a molecular weight of 276.29 g/mol. Its IUPAC name is sodium;4-ethoxynaphthalene-1-sulfonic acid;hydride.
| Compound Name | sodium;4-ethoxynaphthalene-1-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173109617 |
| Molecular Formula | C12H13NaO4S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | sodium;4-ethoxynaphthalene-1-sulfonic acid;hydride |
| SMILES | CCOc1ccc(S(=O)(=O)O)c2ccccc12.[H-].[Na+] |
| InChI | InChI=1S/C12H12O4S.Na.H/c1-2-16-11-7-8-12(17(13,14)15)10-6-4-3-5-9(10)11;;/h3-8H,2H2,1H3,(H,13,14,15);;/q;+1;-1 |
| InChIKey | KHEDRZFYHHTHSI-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|